About 3-(1,2-dihydropyrrol-2-id-3-yl)-2H-pyridin-2-ide;yttrium
3-(1,2-dihydropyrrol-2-id-3-yl)-2H-pyridin-2-ide;yttrium (PubChem CID 58813466) has the molecular formula C9H6N2Y-2
and a molecular weight of 231.07 g/mol. Its IUPAC name is 3-(1,2-dihydropyrrol-2-id-3-yl)-2H-pyridin-2-ide;yttrium.
Molecular Properties
| Compound Name | 3-(1,2-dihydropyrrol-2-id-3-yl)-2H-pyridin-2-ide;yttrium |
| PubChem CID | 58813466 |
| Molecular Formula | C9H6N2Y-2 |
| Molecular Weight | 231.07 g/mol |
| Exact Mass | 230.96 |
| IUPAC Name | 3-(1,2-dihydropyrrol-2-id-3-yl)-2H-pyridin-2-ide;yttrium |
| SMILES | [Y].[c-]1ncccc1-c1[c-][nH]cc1 |
| InChI | InChI=1S/C9H6N2.Y/c1-2-8(6-10-4-1)9-3-5-11-7-9;/h1-5,11H;/q-2; |
| InChIKey | PJEPXVPVRKMTRZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.07 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,2-dihydropyrrol-2-id-3-yl)-2H-pyridin-2-ide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,2-dihydropyrrol-2-id-3-yl)-2H-pyridin-2-ide;yttrium?
The IUPAC name of 3-(1,2-dihydropyrrol-2-id-3-yl)-2H-pyridin-2-ide;yttrium (CID 58813466) is 3-(1,2-dihydropyrrol-2-id-3-yl)-2H-pyridin-2-ide;yttrium.
What is the SMILES notation for 3-(1,2-dihydropyrrol-2-id-3-yl)-2H-pyridin-2-ide;yttrium?
The canonical SMILES for 3-(1,2-dihydropyrrol-2-id-3-yl)-2H-pyridin-2-ide;yttrium is [Y].[c-]1ncccc1-c1[c-][nH]cc1.
What is the InChIKey of 3-(1,2-dihydropyrrol-2-id-3-yl)-2H-pyridin-2-ide;yttrium?
The InChIKey is PJEPXVPVRKMTRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2.Y/c1-2-8(6-10-4-1)9-3-5-11-7-9;/h1-5,11H;/q-2;.
What are the key properties of 3-(1,2-dihydropyrrol-2-id-3-yl)-2H-pyridin-2-ide;yttrium?
3-(1,2-dihydropyrrol-2-id-3-yl)-2H-pyridin-2-ide;yttrium has a molecular weight of 231.07 g/mol, XLogP of 1.67, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2-dihydropyrrol-2-id-3-yl)-2H-pyridin-2-ide;yttrium is sourced from PubChem (CID 58813466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).