C9H6N2Y-2 — CID 58813407
3-(1,3-dihydropyrrol-3-id-2-yl)-2H-pyridin-2-ide;yttrium (PubChem CID 58813407) has the molecular formula C9H6N2Y-2 and a molecular weight of 231.07 g/mol. Its IUPAC name is 3-(1,3-dihydropyrrol-3-id-2-yl)-2H-pyridin-2-ide;yttrium.
| Compound Name | 3-(1,3-dihydropyrrol-3-id-2-yl)-2H-pyridin-2-ide;yttrium |
|---|---|
| PubChem CID | 58813407 |
| Molecular Formula | C9H6N2Y-2 |
| Molecular Weight | 231.07 g/mol |
| Exact Mass | 230.96 |
| IUPAC Name | 3-(1,3-dihydropyrrol-3-id-2-yl)-2H-pyridin-2-ide;yttrium |
| SMILES | [Y].[c-]1ncccc1-c1[c-]cc[nH]1 |
| InChI | InChI=1S/C9H6N2.Y/c1-3-8(7-10-5-1)9-4-2-6-11-9;/h1-3,5-6,11H;/q-2; |
| InChIKey | DVSFWXHWJMSLEO-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.07 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|