C9H10N2 — CID 59096491
3-(1,2-dihydropyrrol-3-ylidenemethyl)-2H-pyrrole (PubChem CID 59096491) has the molecular formula C9H10N2 and a molecular weight of 146.19 g/mol. Its IUPAC name is 3-(1,2-dihydropyrrol-3-ylidenemethyl)-2H-pyrrole.
| Compound Name | 3-(1,2-dihydropyrrol-3-ylidenemethyl)-2H-pyrrole |
|---|---|
| PubChem CID | 59096491 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 3-(1,2-dihydropyrrol-3-ylidenemethyl)-2H-pyrrole |
| SMILES | C1=CC(=CC2=CC=NC2)CN1 |
| InChI | InChI=1S/C9H10N2/c1-3-10-6-8(1)5-9-2-4-11-7-9/h1-5,10H,6-7H2 |
| InChIKey | DKGQGVJYJPPUDO-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |