C17H20BrFN2O2S — CID 58817714
tert-butyl 4-(2-bromo-6-fluoro-1-benzothiophen-3-yl)piperazine-1-carboxylate (PubChem CID 58817714) has the molecular formula C17H20BrFN2O2S and a molecular weight of 415.33 g/mol. Its IUPAC name is tert-butyl 4-(2-bromo-6-fluoro-1-benzothiophen-3-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-bromo-6-fluoro-1-benzothiophen-3-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 58817714 |
| Molecular Formula | C17H20BrFN2O2S |
| Molecular Weight | 415.33 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | tert-butyl 4-(2-bromo-6-fluoro-1-benzothiophen-3-yl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2c(Br)sc3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C17H20BrFN2O2S/c1-17(2,3)23-16(22)21-8-6-20(7-9-21)14-12-5-4-11(19)10-13(12)24-15(14)18/h4-5,10H,6-9H2,1-3H3 |
| InChIKey | FPRWGQUJGGYDSY-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.33 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |