C19H21FN2O4 — CID 88563088
tert-butyl 4-[2-(4-fluorophenyl)-3,4-dioxocyclobuten-1-yl]piperazine-1-carboxylate (PubChem CID 88563088) has the molecular formula C19H21FN2O4 and a molecular weight of 360.39 g/mol. Its IUPAC name is tert-butyl 4-[2-(4-fluorophenyl)-3,4-dioxocyclobuten-1-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(4-fluorophenyl)-3,4-dioxocyclobuten-1-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 88563088 |
| Molecular Formula | C19H21FN2O4 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | tert-butyl 4-[2-(4-fluorophenyl)-3,4-dioxocyclobuten-1-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2c(-c3ccc(F)cc3)c(=O)c2=O)CC1 |
| InChI | InChI=1S/C19H21FN2O4/c1-19(2,3)26-18(25)22-10-8-21(9-11-22)15-14(16(23)17(15)24)12-4-6-13(20)7-5-12/h4-7H,8-11H2,1-3H3 |
| InChIKey | IZYDPWHWZPIRAZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|