C11H15F9O2 — CID 58820910
2,2,3-trifluoro-3-[1,1,1,3,3,3-hexafluoro-2-[(2-methylpropan-2-yl)oxy]propan-2-yl]oxybutane (PubChem CID 58820910) has the molecular formula C11H15F9O2 and a molecular weight of 350.22 g/mol. Its IUPAC name is 2,2,3-trifluoro-3-[1,1,1,3,3,3-hexafluoro-2-[(2-methylpropan-2-yl)oxy]propan-2-yl]oxybutane.
| Compound Name | 2,2,3-trifluoro-3-[1,1,1,3,3,3-hexafluoro-2-[(2-methylpropan-2-yl)oxy]propan-2-yl]oxybutane |
|---|---|
| PubChem CID | 58820910 |
| Molecular Formula | C11H15F9O2 |
| Molecular Weight | 350.22 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 2,2,3-trifluoro-3-[1,1,1,3,3,3-hexafluoro-2-[(2-methylpropan-2-yl)oxy]propan-2-yl]oxybutane |
| SMILES | CC(C)(C)OC(OC(C)(F)C(C)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H15F9O2/c1-6(2,3)21-9(10(15,16)17,11(18,19)20)22-8(5,14)7(4,12)13/h1-5H3 |
| InChIKey | HSJYDINPCMVUIE-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.22 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|