C23H26N4O3 — CID 58824896
methyl 3-[[5-[3-(dimethylamino)propoxy]-1,4-dihydroindeno[2,1-d]pyrazol-3-yl]amino]benzoate (PubChem CID 58824896) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is methyl 3-[[5-[3-(dimethylamino)propoxy]-1,4-dihydroindeno[2,1-d]pyrazol-3-yl]amino]benzoate.
| Compound Name | methyl 3-[[5-[3-(dimethylamino)propoxy]-1,4-dihydroindeno[2,1-d]pyrazol-3-yl]amino]benzoate |
|---|---|
| PubChem CID | 58824896 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | methyl 3-[[5-[3-(dimethylamino)propoxy]-1,4-dihydroindeno[2,1-d]pyrazol-3-yl]amino]benzoate |
| SMILES | COC(=O)c1cccc(Nc2n[nH]c3c2Cc2c(OCCCN(C)C)cccc2-3)c1 |
| InChI | InChI=1S/C23H26N4O3/c1-27(2)11-6-12-30-20-10-5-9-17-18(20)14-19-21(17)25-26-22(19)24-16-8-4-7-15(13-16)23(28)29-3/h4-5,7-10,13H,6,11-12,14H2,1-3H3,(H2,24,25,26) |
| InChIKey | LQYJZRILVCXXTC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|