C28H25FO8S3 — CID 58825165
[2-[4-(benzenesulfonyl)phenoxy]-5-(2-phenylpropan-2-yl)phenyl]sulfonyl-fluoromethanesulfonic acid (PubChem CID 58825165) has the molecular formula C28H25FO8S3 and a molecular weight of 604.70 g/mol. Its IUPAC name is [2-[4-(benzenesulfonyl)phenoxy]-5-(2-phenylpropan-2-yl)phenyl]sulfonyl-fluoromethanesulfonic acid.
| Compound Name | [2-[4-(benzenesulfonyl)phenoxy]-5-(2-phenylpropan-2-yl)phenyl]sulfonyl-fluoromethanesulfonic acid |
|---|---|
| PubChem CID | 58825165 |
| Molecular Formula | C28H25FO8S3 |
| Molecular Weight | 604.70 g/mol |
| Exact Mass | 604.07 |
| IUPAC Name | [2-[4-(benzenesulfonyl)phenoxy]-5-(2-phenylpropan-2-yl)phenyl]sulfonyl-fluoromethanesulfonic acid |
| SMILES | CC(C)(c1ccccc1)c1ccc(Oc2ccc(S(=O)(=O)c3ccccc3)cc2)c(S(=O)(=O)C(F)S(=O)(=O)O)c1 |
| InChI | InChI=1S/C28H25FO8S3/c1-28(2,20-9-5-3-6-10-20)21-13-18-25(26(19-21)39(32,33)27(29)40(34,35)36)37-22-14-16-24(17-15-22)38(30,31)23-11-7-4-8-12-23/h3-19,27H,1-2H3,(H,34,35,36) |
| InChIKey | GALBRPLJZIJVQU-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.70 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|