C28H24F2O8S3 — CID 58825171
[2-[4-(benzenesulfonyl)phenoxy]-5-(2-phenylpropan-2-yl)phenyl]sulfonyl-difluoromethanesulfonic acid (PubChem CID 58825171) has the molecular formula C28H24F2O8S3 and a molecular weight of 622.69 g/mol. Its IUPAC name is [2-[4-(benzenesulfonyl)phenoxy]-5-(2-phenylpropan-2-yl)phenyl]sulfonyl-difluoromethanesulfonic acid.
| Compound Name | [2-[4-(benzenesulfonyl)phenoxy]-5-(2-phenylpropan-2-yl)phenyl]sulfonyl-difluoromethanesulfonic acid |
|---|---|
| PubChem CID | 58825171 |
| Molecular Formula | C28H24F2O8S3 |
| Molecular Weight | 622.69 g/mol |
| Exact Mass | 622.06 |
| IUPAC Name | [2-[4-(benzenesulfonyl)phenoxy]-5-(2-phenylpropan-2-yl)phenyl]sulfonyl-difluoromethanesulfonic acid |
| SMILES | CC(C)(c1ccccc1)c1ccc(Oc2ccc(S(=O)(=O)c3ccccc3)cc2)c(S(=O)(=O)C(F)(F)S(=O)(=O)O)c1 |
| InChI | InChI=1S/C28H24F2O8S3/c1-27(2,20-9-5-3-6-10-20)21-13-18-25(26(19-21)40(33,34)28(29,30)41(35,36)37)38-22-14-16-24(17-15-22)39(31,32)23-11-7-4-8-12-23/h3-19H,1-2H3,(H,35,36,37) |
| InChIKey | VOEXBYPSXZJADQ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.69 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|