C25H21N5O — CID 58829057
N-[3-(2-aminoquinazolin-6-yl)-4-methylphenyl]-1-methylindole-2-carboxamide (PubChem CID 58829057) has the molecular formula C25H21N5O and a molecular weight of 407.48 g/mol. Its IUPAC name is N-[3-(2-aminoquinazolin-6-yl)-4-methylphenyl]-1-methylindole-2-carboxamide.
| Compound Name | N-[3-(2-aminoquinazolin-6-yl)-4-methylphenyl]-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 58829057 |
| Molecular Formula | C25H21N5O |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | N-[3-(2-aminoquinazolin-6-yl)-4-methylphenyl]-1-methylindole-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc3ccccc3n2C)cc1-c1ccc2nc(N)ncc2c1 |
| InChI | InChI=1S/C25H21N5O/c1-15-7-9-19(28-24(31)23-12-17-5-3-4-6-22(17)30(23)2)13-20(15)16-8-10-21-18(11-16)14-27-25(26)29-21/h3-14H,1-2H3,(H,28,31)(H2,26,27,29) |
| InChIKey | NRDBXJYCMFYHLP-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |