C24H23N5O3 — CID 58829478
1-[3-(2-aminoquinazolin-6-yl)-4-methylphenyl]-3-(3,5-dimethoxyphenyl)urea (PubChem CID 58829478) has the molecular formula C24H23N5O3 and a molecular weight of 429.48 g/mol. Its IUPAC name is 1-[3-(2-aminoquinazolin-6-yl)-4-methylphenyl]-3-(3,5-dimethoxyphenyl)urea.
| Compound Name | 1-[3-(2-aminoquinazolin-6-yl)-4-methylphenyl]-3-(3,5-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 58829478 |
| Molecular Formula | C24H23N5O3 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 1-[3-(2-aminoquinazolin-6-yl)-4-methylphenyl]-3-(3,5-dimethoxyphenyl)urea |
| SMILES | COc1cc(NC(=O)Nc2ccc(C)c(-c3ccc4nc(N)ncc4c3)c2)cc(OC)c1 |
| InChI | InChI=1S/C24H23N5O3/c1-14-4-6-17(27-24(30)28-18-9-19(31-2)12-20(10-18)32-3)11-21(14)15-5-7-22-16(8-15)13-26-23(25)29-22/h4-13H,1-3H3,(H2,25,26,29)(H2,27,28,30) |
| InChIKey | WBAYSFZFMOMRTO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |