C49H52F2N2O6 — CID 58836586
4-[(2,3-difluoro-4-methylphenyl)methyl]-5-methyl-1-propan-2-yl-3-[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypyrazole (PubChem CID 58836586) has the molecular formula C49H52F2N2O6 and a molecular weight of 802.96 g/mol. Its IUPAC name is 4-[(2,3-difluoro-4-methylphenyl)methyl]-5-methyl-1-propan-2-yl-3-[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypyrazole.
| Compound Name | 4-[(2,3-difluoro-4-methylphenyl)methyl]-5-methyl-1-propan-2-yl-3-[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypyrazole |
|---|---|
| PubChem CID | 58836586 |
| Molecular Formula | C49H52F2N2O6 |
| Molecular Weight | 802.96 g/mol |
| Exact Mass | 802.38 |
| IUPAC Name | 4-[(2,3-difluoro-4-methylphenyl)methyl]-5-methyl-1-propan-2-yl-3-[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypyrazole |
| SMILES | Cc1ccc(Cc2c(O[C@@H]3O[C@H](COCc4ccccc4)[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@H]3OCc3ccccc3)nn(C(C)C)c2C)c(F)c1F |
| InChI | InChI=1S/C49H52F2N2O6/c1-33(2)53-35(4)41(27-40-26-25-34(3)43(50)44(40)51)48(52-53)59-49-47(57-31-39-23-15-8-16-24-39)46(56-30-38-21-13-7-14-22-38)45(55-29-37-19-11-6-12-20-37)42(58-49)32-54-28-36-17-9-5-10-18-36/h5-26,33,42,45-47,49H,27-32H2,1-4H3/t42-,45-,46+,47-,49+/m1/s1 |
| InChIKey | WOIPUMJBKKLIHT-PEJBUCDQSA-N |
| XLogP | 10.03 |
| TPSA | 73.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.96 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |