C49H53ClN2O8 — CID 87572240
(2R,3R,4S,5R,6R)-2-[4-[(2-chloro-4-methoxyphenyl)methyl]-5-methyl-1-propan-2-ylpyrazol-3-yl]oxy-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol (PubChem CID 87572240) has the molecular formula C49H53ClN2O8 and a molecular weight of 833.42 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-[4-[(2-chloro-4-methoxyphenyl)methyl]-5-methyl-1-propan-2-ylpyrazol-3-yl]oxy-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol.
| Compound Name | (2R,3R,4S,5R,6R)-2-[4-[(2-chloro-4-methoxyphenyl)methyl]-5-methyl-1-propan-2-ylpyrazol-3-yl]oxy-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol |
|---|---|
| PubChem CID | 87572240 |
| Molecular Formula | C49H53ClN2O8 |
| Molecular Weight | 833.42 g/mol |
| Exact Mass | 832.35 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-[4-[(2-chloro-4-methoxyphenyl)methyl]-5-methyl-1-propan-2-ylpyrazol-3-yl]oxy-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol |
| SMILES | COc1ccc(Cc2c(O[C@]3(O)O[C@H](COCc4ccccc4)[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@H]3OCc3ccccc3)nn(C(C)C)c2C)c(Cl)c1 |
| InChI | InChI=1S/C49H53ClN2O8/c1-34(2)52-35(3)42(27-40-25-26-41(54-4)28-43(40)50)48(51-52)60-49(53)47(58-32-39-23-15-8-16-24-39)46(57-31-38-21-13-7-14-22-38)45(56-30-37-19-11-6-12-20-37)44(59-49)33-55-29-36-17-9-5-10-18-36/h5-26,28,34,44-47,53H,27,29-33H2,1-4H3/t44-,45-,46+,47-,49-/m1/s1 |
| InChIKey | LRRYINILLWAKMX-BZTJSMLTSA-N |
| XLogP | 9.42 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.42 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|