C15H23NO3S — CID 58838530
(2R)-1-[2,5-dimethoxy-4-[(E)-2-(methoxymethylsulfanyl)ethenyl]phenyl]propan-2-amine (PubChem CID 58838530) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is (2R)-1-[2,5-dimethoxy-4-[(E)-2-(methoxymethylsulfanyl)ethenyl]phenyl]propan-2-amine.
| Compound Name | (2R)-1-[2,5-dimethoxy-4-[(E)-2-(methoxymethylsulfanyl)ethenyl]phenyl]propan-2-amine |
|---|---|
| PubChem CID | 58838530 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | (2R)-1-[2,5-dimethoxy-4-[(E)-2-(methoxymethylsulfanyl)ethenyl]phenyl]propan-2-amine |
| SMILES | COCS/C=C/c1cc(OC)c(C[C@@H](C)N)cc1OC |
| InChI | InChI=1S/C15H23NO3S/c1-11(16)7-13-9-14(18-3)12(8-15(13)19-4)5-6-20-10-17-2/h5-6,8-9,11H,7,10,16H2,1-4H3/b6-5+/t11-/m1/s1 |
| InChIKey | NGZFSTZIITYLLX-MVIFTORASA-N |
| XLogP | 2.90 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|