C7H14BNO3 — CID 58845534
cis-(1S,3R)-3-[[hydroxy(methyl)boranyl]amino]cyclopentane-1-carboxylic acid (PubChem CID 58845534) has the molecular formula C7H14BNO3 and a molecular weight of 171.00 g/mol. Its IUPAC name is cis-(1S,3R)-3-[[hydroxy(methyl)boranyl]amino]cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1S,3R)-3-[[hydroxy(methyl)boranyl]amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 58845534 |
| Molecular Formula | C7H14BNO3 |
| Molecular Weight | 171.00 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | cis-(1S,3R)-3-[[hydroxy(methyl)boranyl]amino]cyclopentane-1-carboxylic acid |
| SMILES | CB(O)N[C@@H]1CC[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C7H14BNO3/c1-8(12)9-6-3-2-5(4-6)7(10)11/h5-6,9,12H,2-4H2,1H3,(H,10,11)/t5-,6+/m0/s1 |
| InChIKey | MZQULWAFAXSAJD-NTSWFWBYSA-N |
| XLogP | -0.06 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.00 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|