3-(2-ethoxy-2-oxoethoxy)-1,2-oxazole-5-carboxylic acid

C8H9NO6 — CID 58846560

IUPAC3-(2-ethoxy-2-oxoethoxy)-1,2-oxazole-5-carboxylic acid
SMILESCCOC(=O)COc1cc(C(=O)O)on1
InChIInChI=1S/C8H9NO6/c1-2-13-7(10)4-14-6-3-5(8(11)12)15-9-6/h3H,2,4H2,1H3,(H,11,12)
InChIKeyKAWQGTMREXBNIB-UHFFFAOYSA-N
MW215.16 g/mol
LogP0.31
Rot. Bonds5

About 3-(2-ethoxy-2-oxoethoxy)-1,2-oxazole-5-carboxylic acid

3-(2-ethoxy-2-oxoethoxy)-1,2-oxazole-5-carboxylic acid (PubChem CID 58846560) has the molecular formula C8H9NO6 and a molecular weight of 215.16 g/mol. Its IUPAC name is 3-(2-ethoxy-2-oxoethoxy)-1,2-oxazole-5-carboxylic acid.

Molecular Properties

Compound Name3-(2-ethoxy-2-oxoethoxy)-1,2-oxazole-5-carboxylic acid
PubChem CID58846560
Molecular FormulaC8H9NO6
Molecular Weight215.16 g/mol
Exact Mass215.04
IUPAC Name3-(2-ethoxy-2-oxoethoxy)-1,2-oxazole-5-carboxylic acid
SMILESCCOC(=O)COc1cc(C(=O)O)on1
InChIInChI=1S/C8H9NO6/c1-2-13-7(10)4-14-6-3-5(8(11)12)15-9-6/h3H,2,4H2,1H3,(H,11,12)
InChIKeyKAWQGTMREXBNIB-UHFFFAOYSA-N
XLogP0.31
TPSA98.86 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.16
LogP ≤ 50.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze 3-(2-ethoxy-2-oxoethoxy)-1,2-oxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2-ethoxy-2-oxoethoxy)-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 3-(2-ethoxy-2-oxoethoxy)-1,2-oxazole-5-carboxylic acid (CID 58846560) is 3-(2-ethoxy-2-oxoethoxy)-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 3-(2-ethoxy-2-oxoethoxy)-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 3-(2-ethoxy-2-oxoethoxy)-1,2-oxazole-5-carboxylic acid is CCOC(=O)COc1cc(C(=O)O)on1.
What is the InChIKey of 3-(2-ethoxy-2-oxoethoxy)-1,2-oxazole-5-carboxylic acid?
The InChIKey is KAWQGTMREXBNIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO6/c1-2-13-7(10)4-14-6-3-5(8(11)12)15-9-6/h3H,2,4H2,1H3,(H,11,12).
What are the key properties of 3-(2-ethoxy-2-oxoethoxy)-1,2-oxazole-5-carboxylic acid?
3-(2-ethoxy-2-oxoethoxy)-1,2-oxazole-5-carboxylic acid has a molecular weight of 215.16 g/mol, XLogP of 0.31, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-ethoxy-2-oxoethoxy)-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 58846560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).