C28H22N2O — CID 58849536
1-[7,8-dimethyl-3-(phenyliminomethyl)dibenzofuran-2-yl]-N-phenylmethanimine (PubChem CID 58849536) has the molecular formula C28H22N2O and a molecular weight of 402.50 g/mol. Its IUPAC name is 1-[7,8-dimethyl-3-(phenyliminomethyl)dibenzofuran-2-yl]-N-phenylmethanimine.
| Compound Name | 1-[7,8-dimethyl-3-(phenyliminomethyl)dibenzofuran-2-yl]-N-phenylmethanimine |
|---|---|
| PubChem CID | 58849536 |
| Molecular Formula | C28H22N2O |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 1-[7,8-dimethyl-3-(phenyliminomethyl)dibenzofuran-2-yl]-N-phenylmethanimine |
| SMILES | Cc1cc2oc3cc(/C=N/c4ccccc4)c(/C=N/c4ccccc4)cc3c2cc1C |
| InChI | InChI=1S/C28H22N2O/c1-19-13-25-26-15-21(17-29-23-9-5-3-6-10-23)22(18-30-24-11-7-4-8-12-24)16-28(26)31-27(25)14-20(19)2/h3-18H,1-2H3/b29-17+,30-18+ |
| InChIKey | BYVQWVJGMZLHDO-YAGSLNJISA-N |
| XLogP | 7.70 |
| TPSA | 37.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|