C40H32N2Si — CID 59167438
1-[3,7-dimethyl-5,5-diphenyl-2-(phenyliminomethyl)benzo[b][1]benzosilol-8-yl]-N-phenylmethanimine (PubChem CID 59167438) has the molecular formula C40H32N2Si and a molecular weight of 568.80 g/mol. Its IUPAC name is 1-[3,7-dimethyl-5,5-diphenyl-2-(phenyliminomethyl)benzo[b][1]benzosilol-8-yl]-N-phenylmethanimine.
| Compound Name | 1-[3,7-dimethyl-5,5-diphenyl-2-(phenyliminomethyl)benzo[b][1]benzosilol-8-yl]-N-phenylmethanimine |
|---|---|
| PubChem CID | 59167438 |
| Molecular Formula | C40H32N2Si |
| Molecular Weight | 568.80 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | 1-[3,7-dimethyl-5,5-diphenyl-2-(phenyliminomethyl)benzo[b][1]benzosilol-8-yl]-N-phenylmethanimine |
| SMILES | Cc1cc2c(cc1/C=N/c1ccccc1)-c1cc(/C=N/c3ccccc3)c(C)cc1[Si]2(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H32N2Si/c1-29-23-39-37(25-31(29)27-41-33-15-7-3-8-16-33)38-26-32(28-42-34-17-9-4-10-18-34)30(2)24-40(38)43(39,35-19-11-5-12-20-35)36-21-13-6-14-22-36/h3-28H,1-2H3/b41-27+,42-28+ |
| InChIKey | BFJDQRAKRXWQPA-CTQPMARESA-N |
| XLogP | 7.16 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.80 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|