C12H13F11N2O3S — CID 58855441
1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N-(2-morpholin-4-ylethyl)cyclohexane-1-sulfonamide (PubChem CID 58855441) has the molecular formula C12H13F11N2O3S and a molecular weight of 474.29 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N-(2-morpholin-4-ylethyl)cyclohexane-1-sulfonamide.
| Compound Name | 1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N-(2-morpholin-4-ylethyl)cyclohexane-1-sulfonamide |
|---|---|
| PubChem CID | 58855441 |
| Molecular Formula | C12H13F11N2O3S |
| Molecular Weight | 474.29 g/mol |
| Exact Mass | 474.05 |
| IUPAC Name | 1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N-(2-morpholin-4-ylethyl)cyclohexane-1-sulfonamide |
| SMILES | O=S(=O)(NCCN1CCOCC1)C1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C12H13F11N2O3S/c13-7(14)8(15,16)10(19,20)12(23,11(21,22)9(7,17)18)29(26,27)24-1-2-25-3-5-28-6-4-25/h24H,1-6H2 |
| InChIKey | BNQNMFHFWAXVBI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|