C14H14F11NO3 — CID 58855471
1-morpholin-4-ylpropan-2-yl 1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxylate (PubChem CID 58855471) has the molecular formula C14H14F11NO3 and a molecular weight of 453.25 g/mol. Its IUPAC name is 1-morpholin-4-ylpropan-2-yl 1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxylate.
| Compound Name | 1-morpholin-4-ylpropan-2-yl 1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 58855471 |
| Molecular Formula | C14H14F11NO3 |
| Molecular Weight | 453.25 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | 1-morpholin-4-ylpropan-2-yl 1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxylate |
| SMILES | CC(CN1CCOCC1)OC(=O)C1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C14H14F11NO3/c1-7(6-26-2-4-28-5-3-26)29-8(27)9(15)10(16,17)12(20,21)14(24,25)13(22,23)11(9,18)19/h7H,2-6H2,1H3 |
| InChIKey | HWQZFOWSBDSYOM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.25 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|