C13H26N2O3S — CID 59117409
1-morpholin-4-ylpropan-2-yl (2S)-2-(methylamino)-4-methylsulfanylbutanoate (PubChem CID 59117409) has the molecular formula C13H26N2O3S and a molecular weight of 290.43 g/mol. Its IUPAC name is 1-morpholin-4-ylpropan-2-yl (2S)-2-(methylamino)-4-methylsulfanylbutanoate.
| Compound Name | 1-morpholin-4-ylpropan-2-yl (2S)-2-(methylamino)-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 59117409 |
| Molecular Formula | C13H26N2O3S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 1-morpholin-4-ylpropan-2-yl (2S)-2-(methylamino)-4-methylsulfanylbutanoate |
| SMILES | CN[C@@H](CCSC)C(=O)OC(C)CN1CCOCC1 |
| InChI | InChI=1S/C13H26N2O3S/c1-11(10-15-5-7-17-8-6-15)18-13(16)12(14-2)4-9-19-3/h11-12,14H,4-10H2,1-3H3/t11?,12-/m0/s1 |
| InChIKey | JRLXZBWDQPRXTH-KIYNQFGBSA-N |
| XLogP | 0.59 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |