C15H33NSi — CID 58855776
2,2-dimethylpropyl-[(1-ethylpiperidin-4-yl)methyl]-dimethylsilane (PubChem CID 58855776) has the molecular formula C15H33NSi and a molecular weight of 255.52 g/mol. Its IUPAC name is 2,2-dimethylpropyl-[(1-ethylpiperidin-4-yl)methyl]-dimethylsilane.
| Compound Name | 2,2-dimethylpropyl-[(1-ethylpiperidin-4-yl)methyl]-dimethylsilane |
|---|---|
| PubChem CID | 58855776 |
| Molecular Formula | C15H33NSi |
| Molecular Weight | 255.52 g/mol |
| Exact Mass | 255.24 |
| IUPAC Name | 2,2-dimethylpropyl-[(1-ethylpiperidin-4-yl)methyl]-dimethylsilane |
| SMILES | CCN1CCC(C[Si](C)(C)CC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H33NSi/c1-7-16-10-8-14(9-11-16)12-17(5,6)13-15(2,3)4/h14H,7-13H2,1-6H3 |
| InChIKey | QZPOGRFEXXIKIX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|