C14H25N3O4 — CID 58862832
N-(3-ethenoxypropyl)-2-[[2-(3-ethenoxypropylamino)-2-oxoethyl]amino]acetamide (PubChem CID 58862832) has the molecular formula C14H25N3O4 and a molecular weight of 299.37 g/mol. Its IUPAC name is N-(3-ethenoxypropyl)-2-[[2-(3-ethenoxypropylamino)-2-oxoethyl]amino]acetamide.
| Compound Name | N-(3-ethenoxypropyl)-2-[[2-(3-ethenoxypropylamino)-2-oxoethyl]amino]acetamide |
|---|---|
| PubChem CID | 58862832 |
| Molecular Formula | C14H25N3O4 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | N-(3-ethenoxypropyl)-2-[[2-(3-ethenoxypropylamino)-2-oxoethyl]amino]acetamide |
| SMILES | C=COCCCNC(=O)CNCC(=O)NCCCOC=C |
| InChI | InChI=1S/C14H25N3O4/c1-3-20-9-5-7-16-13(18)11-15-12-14(19)17-8-6-10-21-4-2/h3-4,15H,1-2,5-12H2,(H,16,18)(H,17,19) |
| InChIKey | FVQRKPGIKUMBIY-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|