C23H35N7O — CID 58865873
2-[4-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]amino]-N-ethylanilino]ethanol (PubChem CID 58865873) has the molecular formula C23H35N7O and a molecular weight of 425.58 g/mol. Its IUPAC name is 2-[4-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]amino]-N-ethylanilino]ethanol.
| Compound Name | 2-[4-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]amino]-N-ethylanilino]ethanol |
|---|---|
| PubChem CID | 58865873 |
| Molecular Formula | C23H35N7O |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.29 |
| IUPAC Name | 2-[4-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]amino]-N-ethylanilino]ethanol |
| SMILES | CCN(CCO)c1ccc(Nc2nc(N3CCCCC3)nc(N3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C23H35N7O/c1-2-28(17-18-31)20-11-9-19(10-12-20)24-21-25-22(29-13-5-3-6-14-29)27-23(26-21)30-15-7-4-8-16-30/h9-12,31H,2-8,13-18H2,1H3,(H,24,25,26,27) |
| InChIKey | BBSUCSYCXPLGQO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|