C31H44IrNO2- — CID 58871317
2-(2,3-dimethylbenzene-6-id-1-yl)-3,5,7-trimethylquinoline;iridium;2,2,6,6-tetramethylheptane-3,5-diol (PubChem CID 58871317) has the molecular formula C31H44IrNO2- and a molecular weight of 654.92 g/mol. Its IUPAC name is 2-(2,3-dimethylbenzene-6-id-1-yl)-3,5,7-trimethylquinoline;iridium;2,2,6,6-tetramethylheptane-3,5-diol.
| Compound Name | 2-(2,3-dimethylbenzene-6-id-1-yl)-3,5,7-trimethylquinoline;iridium;2,2,6,6-tetramethylheptane-3,5-diol |
|---|---|
| PubChem CID | 58871317 |
| Molecular Formula | C31H44IrNO2- |
| Molecular Weight | 654.92 g/mol |
| Exact Mass | 655.30 |
| IUPAC Name | 2-(2,3-dimethylbenzene-6-id-1-yl)-3,5,7-trimethylquinoline;iridium;2,2,6,6-tetramethylheptane-3,5-diol |
| SMILES | CC(C)(C)C(O)CC(O)C(C)(C)C.Cc1cc(C)c2cc(C)c(-c3[c-]ccc(C)c3C)nc2c1.[Ir] |
| InChI | InChI=1S/C20H20N.C11H24O2.Ir/c1-12-9-14(3)18-11-15(4)20(21-19(18)10-12)17-8-6-7-13(2)16(17)5;1-10(2,3)8(12)7-9(13)11(4,5)6;/h6-7,9-11H,1-5H3;8-9,12-13H,7H2,1-6H3;/q-1;; |
| InChIKey | TZOSVSMRXMIEAO-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.92 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|