C23H32ClNO3Si — CID 58878865
(NE)-N-[[3-chloro-2-phenylmethoxy-5-tri(propan-2-yl)silyloxyphenyl]methylidene]hydroxylamine (PubChem CID 58878865) has the molecular formula C23H32ClNO3Si and a molecular weight of 434.05 g/mol. Its IUPAC name is (NE)-N-[[3-chloro-2-phenylmethoxy-5-tri(propan-2-yl)silyloxyphenyl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[3-chloro-2-phenylmethoxy-5-tri(propan-2-yl)silyloxyphenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 58878865 |
| Molecular Formula | C23H32ClNO3Si |
| Molecular Weight | 434.05 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | (NE)-N-[[3-chloro-2-phenylmethoxy-5-tri(propan-2-yl)silyloxyphenyl]methylidene]hydroxylamine |
| SMILES | CC(C)[Si](Oc1cc(Cl)c(OCc2ccccc2)c(/C=N/O)c1)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H32ClNO3Si/c1-16(2)29(17(3)4,18(5)6)28-21-12-20(14-25-26)23(22(24)13-21)27-15-19-10-8-7-9-11-19/h7-14,16-18,26H,15H2,1-6H3/b25-14+ |
| InChIKey | NMMQIZHKBDXQHK-AFUMVMLFSA-N |
| XLogP | 7.28 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.05 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|