C36H41ClO4SSi — CID 20734903
2-(2-chloro-6-hydroxy-4-phenylmethoxyphenyl)sulfanyl-2-phenyl-1-[4-tri(propan-2-yl)silyloxyphenyl]ethanone (PubChem CID 20734903) has the molecular formula C36H41ClO4SSi and a molecular weight of 633.33 g/mol. Its IUPAC name is 2-(2-chloro-6-hydroxy-4-phenylmethoxyphenyl)sulfanyl-2-phenyl-1-[4-tri(propan-2-yl)silyloxyphenyl]ethanone.
| Compound Name | 2-(2-chloro-6-hydroxy-4-phenylmethoxyphenyl)sulfanyl-2-phenyl-1-[4-tri(propan-2-yl)silyloxyphenyl]ethanone |
|---|---|
| PubChem CID | 20734903 |
| Molecular Formula | C36H41ClO4SSi |
| Molecular Weight | 633.33 g/mol |
| Exact Mass | 632.22 |
| IUPAC Name | 2-(2-chloro-6-hydroxy-4-phenylmethoxyphenyl)sulfanyl-2-phenyl-1-[4-tri(propan-2-yl)silyloxyphenyl]ethanone |
| SMILES | CC(C)[Si](Oc1ccc(C(=O)C(Sc2c(O)cc(OCc3ccccc3)cc2Cl)c2ccccc2)cc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C36H41ClO4SSi/c1-24(2)43(25(3)4,26(5)6)41-30-19-17-28(18-20-30)34(39)35(29-15-11-8-12-16-29)42-36-32(37)21-31(22-33(36)38)40-23-27-13-9-7-10-14-27/h7-22,24-26,35,38H,23H2,1-6H3 |
| InChIKey | UYYVLDFQHRXOOW-UHFFFAOYSA-N |
| XLogP | 10.90 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.33 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|