C20H28F3N3O5 — CID 58881678
tert-butyl N-[1-[4-(hydroxymethyl)anilino]-1-oxo-6-[(2,2,2-trifluoroacetyl)amino]hexan-2-yl]carbamate (PubChem CID 58881678) has the molecular formula C20H28F3N3O5 and a molecular weight of 447.45 g/mol. Its IUPAC name is tert-butyl N-[1-[4-(hydroxymethyl)anilino]-1-oxo-6-[(2,2,2-trifluoroacetyl)amino]hexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[4-(hydroxymethyl)anilino]-1-oxo-6-[(2,2,2-trifluoroacetyl)amino]hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 58881678 |
| Molecular Formula | C20H28F3N3O5 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | tert-butyl N-[1-[4-(hydroxymethyl)anilino]-1-oxo-6-[(2,2,2-trifluoroacetyl)amino]hexan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CCCCNC(=O)C(F)(F)F)C(=O)Nc1ccc(CO)cc1 |
| InChI | InChI=1S/C20H28F3N3O5/c1-19(2,3)31-18(30)26-15(6-4-5-11-24-17(29)20(21,22)23)16(28)25-14-9-7-13(12-27)8-10-14/h7-10,15,27H,4-6,11-12H2,1-3H3,(H,24,29)(H,25,28)(H,26,30) |
| InChIKey | IOFIIZHWHAVVMB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|