C24H18N6O18S3 — CID 58892216
5-[[4,6-bis(3-carboxy-4-hydroxy-5-sulfoanilino)-1,3,5-triazin-2-yl]amino]-2-hydroxy-3-(trioxidanylsulfanyl)benzoic acid (PubChem CID 58892216) has the molecular formula C24H18N6O18S3 and a molecular weight of 774.63 g/mol. Its IUPAC name is 5-[[4,6-bis(3-carboxy-4-hydroxy-5-sulfoanilino)-1,3,5-triazin-2-yl]amino]-2-hydroxy-3-(trioxidanylsulfanyl)benzoic acid.
| Compound Name | 5-[[4,6-bis(3-carboxy-4-hydroxy-5-sulfoanilino)-1,3,5-triazin-2-yl]amino]-2-hydroxy-3-(trioxidanylsulfanyl)benzoic acid |
|---|---|
| PubChem CID | 58892216 |
| Molecular Formula | C24H18N6O18S3 |
| Molecular Weight | 774.63 g/mol |
| Exact Mass | 773.98 |
| IUPAC Name | 5-[[4,6-bis(3-carboxy-4-hydroxy-5-sulfoanilino)-1,3,5-triazin-2-yl]amino]-2-hydroxy-3-(trioxidanylsulfanyl)benzoic acid |
| SMILES | O=C(O)c1cc(Nc2nc(Nc3cc(C(=O)O)c(O)c(S(=O)(=O)O)c3)nc(Nc3cc(C(=O)O)c(O)c(S(=O)(=O)O)c3)n2)cc(SOOO)c1O |
| InChI | InChI=1S/C24H18N6O18S3/c31-16-10(19(34)35)1-7(4-13(16)49-48-47-40)25-22-28-23(26-8-2-11(20(36)37)17(32)14(5-8)50(41,42)43)30-24(29-22)27-9-3-12(21(38)39)18(33)15(6-9)51(44,45)46/h1-6,31-33,40H,(H,34,35)(H,36,37)(H,38,39)(H,41,42,43)(H,44,45,46)(H3,25,26,27,28,29,30) |
| InChIKey | YBPJUKXGHIDXPX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 394.78 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.63 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|