C10H12F4O — CID 58894685
1,1,1-trifluoro-2-(2-fluoro-2-bicyclo[2.2.1]hept-5-enyl)propan-2-ol (PubChem CID 58894685) has the molecular formula C10H12F4O and a molecular weight of 224.20 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-(2-fluoro-2-bicyclo[2.2.1]hept-5-enyl)propan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-(2-fluoro-2-bicyclo[2.2.1]hept-5-enyl)propan-2-ol |
|---|---|
| PubChem CID | 58894685 |
| Molecular Formula | C10H12F4O |
| Molecular Weight | 224.20 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 1,1,1-trifluoro-2-(2-fluoro-2-bicyclo[2.2.1]hept-5-enyl)propan-2-ol |
| SMILES | CC(O)(C(F)(F)F)C1(F)CC2C=CC1C2 |
| InChI | InChI=1S/C10H12F4O/c1-8(15,10(12,13)14)9(11)5-6-2-3-7(9)4-6/h2-3,6-7,15H,4-5H2,1H3 |
| InChIKey | QHMUUSBUQBDTTH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.20 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|