C10H10F6O — CID 58894688
1,1,1-trifluoro-2-(2,3,3-trifluoro-2-bicyclo[2.2.1]hept-5-enyl)propan-2-ol (PubChem CID 58894688) has the molecular formula C10H10F6O and a molecular weight of 260.18 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-(2,3,3-trifluoro-2-bicyclo[2.2.1]hept-5-enyl)propan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-(2,3,3-trifluoro-2-bicyclo[2.2.1]hept-5-enyl)propan-2-ol |
|---|---|
| PubChem CID | 58894688 |
| Molecular Formula | C10H10F6O |
| Molecular Weight | 260.18 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 1,1,1-trifluoro-2-(2,3,3-trifluoro-2-bicyclo[2.2.1]hept-5-enyl)propan-2-ol |
| SMILES | CC(O)(C(F)(F)F)C1(F)C2C=CC(C2)C1(F)F |
| InChI | InChI=1S/C10H10F6O/c1-7(17,10(14,15)16)8(11)5-2-3-6(4-5)9(8,12)13/h2-3,5-6,17H,4H2,1H3 |
| InChIKey | HGKVOIBUAXGMEX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.18 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|