C8H7N2W2- — CID 58896515
3,4-dihydroindol-4-id-2-amine;tungsten (PubChem CID 58896515) has the molecular formula C8H7N2W2- and a molecular weight of 498.84 g/mol. Its IUPAC name is 3,4-dihydroindol-4-id-2-amine;tungsten.
| Compound Name | 3,4-dihydroindol-4-id-2-amine;tungsten |
|---|---|
| PubChem CID | 58896515 |
| Molecular Formula | C8H7N2W2- |
| Molecular Weight | 498.84 g/mol |
| Exact Mass | 498.96 |
| IUPAC Name | 3,4-dihydroindol-4-id-2-amine;tungsten |
| SMILES | NC1=Nc2ccc[c-]c2C1.[W].[W] |
| InChI | InChI=1S/C8H7N2.2W/c9-8-5-6-3-1-2-4-7(6)10-8;;/h1-2,4H,5H2,(H2,9,10);;/q-1;; |
| InChIKey | WXBLXEKEDKHASZ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.84 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|