C12H11N5 — CID 172543727
7,11-diazatricyclo[7.5.0.02,6]tetradeca-1,3,5,7,9,11,13-heptaene-8,10,12-triamine (PubChem CID 172543727) has the molecular formula C12H11N5 and a molecular weight of 225.25 g/mol. Its IUPAC name is 7,11-diazatricyclo[7.5.0.02,6]tetradeca-1,3,5,7,9,11,13-heptaene-8,10,12-triamine.
| Compound Name | 7,11-diazatricyclo[7.5.0.02,6]tetradeca-1,3,5,7,9,11,13-heptaene-8,10,12-triamine |
|---|---|
| PubChem CID | 172543727 |
| Molecular Formula | C12H11N5 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 7,11-diazatricyclo[7.5.0.02,6]tetradeca-1,3,5,7,9,11,13-heptaene-8,10,12-triamine |
| SMILES | Nc1ccc2c(c(N)n1)c(N)nc1cccc12 |
| InChI | InChI=1S/C12H11N5/c13-9-5-4-7-6-2-1-3-8(6)16-11(14)10(7)12(15)17-9/h1-5H,(H2,14,16)(H4,13,15,17) |
| InChIKey | YUADPNCAWURFLB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |