C14H22N4 — CID 142225176
ethane;2-[(5Z,6E)-5-ethylidene-4-methyl-6-prop-2-enylidene-2-pyridinyl]guanidine (PubChem CID 142225176) has the molecular formula C14H22N4 and a molecular weight of 246.36 g/mol. Its IUPAC name is ethane;2-[(5Z,6E)-5-ethylidene-4-methyl-6-prop-2-enylidene-2-pyridinyl]guanidine.
| Compound Name | ethane;2-[(5Z,6E)-5-ethylidene-4-methyl-6-prop-2-enylidene-2-pyridinyl]guanidine |
|---|---|
| PubChem CID | 142225176 |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | ethane;2-[(5Z,6E)-5-ethylidene-4-methyl-6-prop-2-enylidene-2-pyridinyl]guanidine |
| SMILES | C=C/C=c1/nc(N=C(N)N)cc(C)/c1=C/C.CC |
| InChI | InChI=1S/C12H16N4.C2H6/c1-4-6-10-9(5-2)8(3)7-11(15-10)16-12(13)14;1-2/h4-7H,1H2,2-3H3,(H4,13,14,15,16);1-2H3/b9-5-,10-6+; |
| InChIKey | GGYSLFZBTKHUCJ-KSTRYXAPSA-N |
| XLogP | 1.09 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|