C7H7N3 — CID 118514543
7H-pyrrolo[2,3-c]pyridin-5-amine (PubChem CID 118514543) has the molecular formula C7H7N3 and a molecular weight of 133.15 g/mol. Its IUPAC name is 7H-pyrrolo[2,3-c]pyridin-5-amine.
| Compound Name | 7H-pyrrolo[2,3-c]pyridin-5-amine |
|---|---|
| PubChem CID | 118514543 |
| Molecular Formula | C7H7N3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.06 |
| IUPAC Name | 7H-pyrrolo[2,3-c]pyridin-5-amine |
| SMILES | NC1=NCC2=NC=CC2=C1 |
| InChI | InChI=1S/C7H7N3/c8-7-3-5-1-2-9-6(5)4-10-7/h1-3H,4H2,(H2,8,10) |
| InChIKey | QVJXIVKDDHTZDD-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |