C13H11N3 — CID 172544503
cyclopenta[h][2]benzazepine-1,3-diamine (PubChem CID 172544503) has the molecular formula C13H11N3 and a molecular weight of 209.25 g/mol. Its IUPAC name is cyclopenta[h][2]benzazepine-1,3-diamine.
| Compound Name | cyclopenta[h][2]benzazepine-1,3-diamine |
|---|---|
| PubChem CID | 172544503 |
| Molecular Formula | C13H11N3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | cyclopenta[h][2]benzazepine-1,3-diamine |
| SMILES | Nc1ccc2cc3cccc3cc2c(N)n1 |
| InChI | InChI=1S/C13H11N3/c14-12-5-4-10-6-8-2-1-3-9(8)7-11(10)13(15)16-12/h1-7H,(H4,14,15,16) |
| InChIKey | BVYAPAJQWXTHNA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |