C28H29N2O6PS2 — CID 58900512
N-(2-amino-1,2-diphenylethyl)-N-bis-(4-methylphenyl)sulfonylphosphonamidic acid (PubChem CID 58900512) has the molecular formula C28H29N2O6PS2 and a molecular weight of 584.66 g/mol. Its IUPAC name is N-(2-amino-1,2-diphenylethyl)-N-bis-(4-methylphenyl)sulfonylphosphonamidic acid.
| Compound Name | N-(2-amino-1,2-diphenylethyl)-N-bis-(4-methylphenyl)sulfonylphosphonamidic acid |
|---|---|
| PubChem CID | 58900512 |
| Molecular Formula | C28H29N2O6PS2 |
| Molecular Weight | 584.66 g/mol |
| Exact Mass | 584.12 |
| IUPAC Name | N-(2-amino-1,2-diphenylethyl)-N-bis-(4-methylphenyl)sulfonylphosphonamidic acid |
| SMILES | Cc1ccc(S(=O)(=O)N(C(c2ccccc2)C(N)c2ccccc2)P(=O)(O)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C28H29N2O6PS2/c1-21-13-17-25(18-14-21)38(33,34)30(37(31,32)39(35,36)26-19-15-22(2)16-20-26)28(24-11-7-4-8-12-24)27(29)23-9-5-3-6-10-23/h3-20,27-28H,29H2,1-2H3,(H,31,32) |
| InChIKey | AQJKRLAHHKUNBE-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 134.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.66 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|