C2HF2O5S- — CID 58903308
1,1-difluoro-2-hydroxy-2-oxoethanesulfonate (PubChem CID 58903308) has the molecular formula C2HF2O5S- and a molecular weight of 175.09 g/mol. Its IUPAC name is 1,1-difluoro-2-hydroxy-2-oxoethanesulfonate.
| Compound Name | 1,1-difluoro-2-hydroxy-2-oxoethanesulfonate |
|---|---|
| PubChem CID | 58903308 |
| Molecular Formula | C2HF2O5S- |
| Molecular Weight | 175.09 g/mol |
| Exact Mass | 174.95 |
| IUPAC Name | 1,1-difluoro-2-hydroxy-2-oxoethanesulfonate |
| SMILES | O=C(O)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C2H2F2O5S/c3-2(4,1(5)6)10(7,8)9/h(H,5,6)(H,7,8,9)/p-1 |
| InChIKey | YIBFJCKIOIVKIU-UHFFFAOYSA-M |
| XLogP | -0.79 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.09 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|