C3HF4O5S- — CID 155631885
1,1,2,2-tetrafluoro-3-hydroxy-3-oxopropane-1-sulfonate (PubChem CID 155631885) has the molecular formula C3HF4O5S- and a molecular weight of 225.09 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-3-hydroxy-3-oxopropane-1-sulfonate.
| Compound Name | 1,1,2,2-tetrafluoro-3-hydroxy-3-oxopropane-1-sulfonate |
|---|---|
| PubChem CID | 155631885 |
| Molecular Formula | C3HF4O5S- |
| Molecular Weight | 225.09 g/mol |
| Exact Mass | 224.95 |
| IUPAC Name | 1,1,2,2-tetrafluoro-3-hydroxy-3-oxopropane-1-sulfonate |
| SMILES | O=C(O)C(F)(F)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C3H2F4O5S/c4-2(5,1(8)9)3(6,7)13(10,11)12/h(H,8,9)(H,10,11,12)/p-1 |
| InChIKey | NWMVQEZTZDXZDN-UHFFFAOYSA-M |
| XLogP | -0.16 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.09 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|