C16H25NO4 — CID 58907305
tert-butyl (1S,3aS,9bS)-3-oxo-2,3a,4,5a,6,7,8,9,9a,9b-decahydro-1H-chromeno[3,4-c]pyrrole-1-carboxylate (PubChem CID 58907305) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is tert-butyl (1S,3aS,9bS)-3-oxo-2,3a,4,5a,6,7,8,9,9a,9b-decahydro-1H-chromeno[3,4-c]pyrrole-1-carboxylate.
| Compound Name | tert-butyl (1S,3aS,9bS)-3-oxo-2,3a,4,5a,6,7,8,9,9a,9b-decahydro-1H-chromeno[3,4-c]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 58907305 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | tert-butyl (1S,3aS,9bS)-3-oxo-2,3a,4,5a,6,7,8,9,9a,9b-decahydro-1H-chromeno[3,4-c]pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1NC(=O)[C@@H]2COC3CCCCC3[C@H]12 |
| InChI | InChI=1S/C16H25NO4/c1-16(2,3)21-15(19)13-12-9-6-4-5-7-11(9)20-8-10(12)14(18)17-13/h9-13H,4-8H2,1-3H3,(H,17,18)/t9?,10-,11?,12+,13+/m1/s1 |
| InChIKey | MKHGGBRCZHSOBI-LSBUWSJDSA-N |
| XLogP | 1.65 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |