C18H26O5 — CID 53230465
tert-butyl (1S,3aR,4aS,8aS,9S,9aR)-1-methyl-3,4-dioxo-1,3a,4a,5,6,7,8,8a,9,9a-decahydrobenzo[f][2]benzofuran-9-carboxylate (PubChem CID 53230465) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is tert-butyl (1S,3aR,4aS,8aS,9S,9aR)-1-methyl-3,4-dioxo-1,3a,4a,5,6,7,8,8a,9,9a-decahydrobenzo[f][2]benzofuran-9-carboxylate.
| Compound Name | tert-butyl (1S,3aR,4aS,8aS,9S,9aR)-1-methyl-3,4-dioxo-1,3a,4a,5,6,7,8,8a,9,9a-decahydrobenzo[f][2]benzofuran-9-carboxylate |
|---|---|
| PubChem CID | 53230465 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | tert-butyl (1S,3aR,4aS,8aS,9S,9aR)-1-methyl-3,4-dioxo-1,3a,4a,5,6,7,8,8a,9,9a-decahydrobenzo[f][2]benzofuran-9-carboxylate |
| SMILES | C[C@@H]1OC(=O)[C@H]2C(=O)[C@H]3CCCC[C@@H]3[C@H](C(=O)OC(C)(C)C)[C@H]21 |
| InChI | InChI=1S/C18H26O5/c1-9-12-13(17(21)23-18(2,3)4)10-7-5-6-8-11(10)15(19)14(12)16(20)22-9/h9-14H,5-8H2,1-4H3/t9-,10-,11-,12+,13-,14+/m0/s1 |
| InChIKey | GZZMTFYVQJCQKY-ARFNZGECSA-N |
| XLogP | 2.51 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|