C20H29NO6 — CID 58909013
tert-butyl 2-hydroxy-4-(1-hydroxycyclobutyl)-3-(phenylmethoxycarbonylamino)butanoate (PubChem CID 58909013) has the molecular formula C20H29NO6 and a molecular weight of 379.45 g/mol. Its IUPAC name is tert-butyl 2-hydroxy-4-(1-hydroxycyclobutyl)-3-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | tert-butyl 2-hydroxy-4-(1-hydroxycyclobutyl)-3-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 58909013 |
| Molecular Formula | C20H29NO6 |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | tert-butyl 2-hydroxy-4-(1-hydroxycyclobutyl)-3-(phenylmethoxycarbonylamino)butanoate |
| SMILES | CC(C)(C)OC(=O)C(O)C(CC1(O)CCC1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H29NO6/c1-19(2,3)27-17(23)16(22)15(12-20(25)10-7-11-20)21-18(24)26-13-14-8-5-4-6-9-14/h4-6,8-9,15-16,22,25H,7,10-13H2,1-3H3,(H,21,24) |
| InChIKey | BIRIXWNZQIGPEN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |