C29H44N2O5Si — CID 58913170
tert-butyl N-[(2R,3R)-3-[[3-[[4-[tert-butyl(dimethyl)silyl]oxybenzoyl]amino]phenyl]methoxy]butan-2-yl]carbamate (PubChem CID 58913170) has the molecular formula C29H44N2O5Si and a molecular weight of 528.77 g/mol. Its IUPAC name is tert-butyl N-[(2R,3R)-3-[[3-[[4-[tert-butyl(dimethyl)silyl]oxybenzoyl]amino]phenyl]methoxy]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3R)-3-[[3-[[4-[tert-butyl(dimethyl)silyl]oxybenzoyl]amino]phenyl]methoxy]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 58913170 |
| Molecular Formula | C29H44N2O5Si |
| Molecular Weight | 528.77 g/mol |
| Exact Mass | 528.30 |
| IUPAC Name | tert-butyl N-[(2R,3R)-3-[[3-[[4-[tert-butyl(dimethyl)silyl]oxybenzoyl]amino]phenyl]methoxy]butan-2-yl]carbamate |
| SMILES | C[C@@H](NC(=O)OC(C)(C)C)[C@@H](C)OCc1cccc(NC(=O)c2ccc(O[Si](C)(C)C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C29H44N2O5Si/c1-20(30-27(33)35-28(3,4)5)21(2)34-19-22-12-11-13-24(18-22)31-26(32)23-14-16-25(17-15-23)36-37(9,10)29(6,7)8/h11-18,20-21H,19H2,1-10H3,(H,30,33)(H,31,32)/t20-,21-/m1/s1 |
| InChIKey | RBYQVNVNPPEQMG-NHCUHLMSSA-N |
| XLogP | 7.14 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.77 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|