C33H44N2O8 — CID 140529812
ditert-butyl (3S)-2-[[3-[(4-ethenylbenzoyl)amino]phenyl]methoxy]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate (PubChem CID 140529812) has the molecular formula C33H44N2O8 and a molecular weight of 596.72 g/mol. Its IUPAC name is ditert-butyl (3S)-2-[[3-[(4-ethenylbenzoyl)amino]phenyl]methoxy]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate.
| Compound Name | ditert-butyl (3S)-2-[[3-[(4-ethenylbenzoyl)amino]phenyl]methoxy]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
|---|---|
| PubChem CID | 140529812 |
| Molecular Formula | C33H44N2O8 |
| Molecular Weight | 596.72 g/mol |
| Exact Mass | 596.31 |
| IUPAC Name | ditert-butyl (3S)-2-[[3-[(4-ethenylbenzoyl)amino]phenyl]methoxy]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
| SMILES | C=Cc1ccc(C(=O)Nc2cccc(COC(C(=O)OC(C)(C)C)[C@H](NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C33H44N2O8/c1-11-21-15-17-23(18-16-21)27(36)34-24-14-12-13-22(19-24)20-40-26(29(38)42-32(5,6)7)25(28(37)41-31(2,3)4)35-30(39)43-33(8,9)10/h11-19,25-26H,1,20H2,2-10H3,(H,34,36)(H,35,39)/t25-,26?/m0/s1 |
| InChIKey | OBTIYKRXXILFFK-PMCHYTPCSA-N |
| XLogP | 6.04 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.72 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|