C27H23ClF7N3O2 — CID 58920320
1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-(3,3-difluorocyclopentyl)urea (PubChem CID 58920320) has the molecular formula C27H23ClF7N3O2 and a molecular weight of 589.90 g/mol. Its IUPAC name is 1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-(3,3-difluorocyclopentyl)urea.
| Compound Name | 1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-(3,3-difluorocyclopentyl)urea |
|---|---|
| PubChem CID | 58920320 |
| Molecular Formula | C27H23ClF7N3O2 |
| Molecular Weight | 589.90 g/mol |
| Exact Mass | 589.14 |
| IUPAC Name | 1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-(3,3-difluorocyclopentyl)urea |
| SMILES | C1CC(CC1NC(=O)N[C@](CC2=CC=CC=C2)(C3=NC=C(C=C3)Cl)C4=CC(=CC(=C4)F)OC(C(F)F)(F)F)(F)F |
| InChI | InChI=1S/C27H23ClF7N3O2/c28-18-6-7-22(36-15-18)26(13-16-4-2-1-3-5-16,38-24(39)37-20-8-9-25(32,33)14-20)17-10-19(29)12-21(11-17)40-27(34,35)23(30)31/h1-7,10-12,15,20,23H,8-9,13-14H2,(H2,37,38,39)/t20?,26-/m0/s1 |
| InChIKey | AMAKXBAXHDIALG-GHZUAHJPSA-N |
| XLogP | 7.20 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | 851 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.90 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|