C19H23NO7 — CID 58928029
3-O-tert-butyl 2-O-methyl 2-acetyloxy-5-oxo-1,4-dihydro-3-benzazepine-2,3-dicarboxylate (PubChem CID 58928029) has the molecular formula C19H23NO7 and a molecular weight of 377.39 g/mol. Its IUPAC name is 3-O-tert-butyl 2-O-methyl 2-acetyloxy-5-oxo-1,4-dihydro-3-benzazepine-2,3-dicarboxylate.
| Compound Name | 3-O-tert-butyl 2-O-methyl 2-acetyloxy-5-oxo-1,4-dihydro-3-benzazepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 58928029 |
| Molecular Formula | C19H23NO7 |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 3-O-tert-butyl 2-O-methyl 2-acetyloxy-5-oxo-1,4-dihydro-3-benzazepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1(OC(C)=O)Cc2ccccc2C(=O)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H23NO7/c1-12(21)26-19(16(23)25-5)10-13-8-6-7-9-14(13)15(22)11-20(19)17(24)27-18(2,3)4/h6-9H,10-11H2,1-5H3 |
| InChIKey | XSLPSUISFCPSTB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|