C30H20ClN3O4 — CID 58931171
phenyl N-[2-chloro-4-(6-isocyano-7-phenylmethoxyquinolin-4-yl)oxyphenyl]carbamate (PubChem CID 58931171) has the molecular formula C30H20ClN3O4 and a molecular weight of 521.96 g/mol. Its IUPAC name is phenyl N-[2-chloro-4-(6-isocyano-7-phenylmethoxyquinolin-4-yl)oxyphenyl]carbamate.
| Compound Name | phenyl N-[2-chloro-4-(6-isocyano-7-phenylmethoxyquinolin-4-yl)oxyphenyl]carbamate |
|---|---|
| PubChem CID | 58931171 |
| Molecular Formula | C30H20ClN3O4 |
| Molecular Weight | 521.96 g/mol |
| Exact Mass | 521.11 |
| IUPAC Name | phenyl N-[2-chloro-4-(6-isocyano-7-phenylmethoxyquinolin-4-yl)oxyphenyl]carbamate |
| SMILES | [C-]#[N+]c1cc2c(Oc3ccc(NC(=O)Oc4ccccc4)c(Cl)c3)ccnc2cc1OCc1ccccc1 |
| InChI | InChI=1S/C30H20ClN3O4/c1-32-27-17-23-26(18-29(27)36-19-20-8-4-2-5-9-20)33-15-14-28(23)37-22-12-13-25(24(31)16-22)34-30(35)38-21-10-6-3-7-11-21/h2-18H,19H2,(H,34,35) |
| InChIKey | RJRXGXZBTBRJDO-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 74.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.96 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|