C34H31ClN4O4 — CID 156558865
1-[2-chloro-4-[7-phenylmethoxy-6-(1-prop-2-enoyl-3,6-dihydro-2H-pyridin-4-yl)quinolin-4-yl]oxyphenyl]-3-cyclopropylurea (PubChem CID 156558865) has the molecular formula C34H31ClN4O4 and a molecular weight of 595.10 g/mol. Its IUPAC name is 1-[2-chloro-4-[7-phenylmethoxy-6-(1-prop-2-enoyl-3,6-dihydro-2H-pyridin-4-yl)quinolin-4-yl]oxyphenyl]-3-cyclopropylurea.
| Compound Name | 1-[2-chloro-4-[7-phenylmethoxy-6-(1-prop-2-enoyl-3,6-dihydro-2H-pyridin-4-yl)quinolin-4-yl]oxyphenyl]-3-cyclopropylurea |
|---|---|
| PubChem CID | 156558865 |
| Molecular Formula | C34H31ClN4O4 |
| Molecular Weight | 595.10 g/mol |
| Exact Mass | 594.20 |
| IUPAC Name | 1-[2-chloro-4-[7-phenylmethoxy-6-(1-prop-2-enoyl-3,6-dihydro-2H-pyridin-4-yl)quinolin-4-yl]oxyphenyl]-3-cyclopropylurea |
| SMILES | C=CC(=O)N1CC=C(c2cc3c(Oc4ccc(NC(=O)NC5CC5)c(Cl)c4)ccnc3cc2OCc2ccccc2)CC1 |
| InChI | InChI=1S/C34H31ClN4O4/c1-2-33(40)39-16-13-23(14-17-39)26-19-27-30(20-32(26)42-21-22-6-4-3-5-7-22)36-15-12-31(27)43-25-10-11-29(28(35)18-25)38-34(41)37-24-8-9-24/h2-7,10-13,15,18-20,24H,1,8-9,14,16-17,21H2,(H2,37,38,41) |
| InChIKey | UJQCNTMNVZAVGF-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.10 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|