C33H24N4O7P2 — CID 58931662
[2-(2-dipyridin-2-yloxyphosphanyloxybenzoyl)phenyl] dipyridin-2-yl phosphite (PubChem CID 58931662) has the molecular formula C33H24N4O7P2 and a molecular weight of 650.52 g/mol. Its IUPAC name is [2-(2-dipyridin-2-yloxyphosphanyloxybenzoyl)phenyl] dipyridin-2-yl phosphite.
| Compound Name | [2-(2-dipyridin-2-yloxyphosphanyloxybenzoyl)phenyl] dipyridin-2-yl phosphite |
|---|---|
| PubChem CID | 58931662 |
| Molecular Formula | C33H24N4O7P2 |
| Molecular Weight | 650.52 g/mol |
| Exact Mass | 650.11 |
| IUPAC Name | [2-(2-dipyridin-2-yloxyphosphanyloxybenzoyl)phenyl] dipyridin-2-yl phosphite |
| SMILES | O=C(c1ccccc1OP(Oc1ccccn1)Oc1ccccn1)c1ccccc1OP(Oc1ccccn1)Oc1ccccn1 |
| InChI | InChI=1S/C33H24N4O7P2/c38-33(25-13-1-3-15-27(25)39-45(41-29-17-5-9-21-34-29)42-30-18-6-10-22-35-30)26-14-2-4-16-28(26)40-46(43-31-19-7-11-23-36-31)44-32-20-8-12-24-37-32/h1-24H |
| InChIKey | LGJQQCKWLHOXKT-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 124.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.52 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|