C24H30N2S — CID 58933101
4-butyl-N-[1-(2-phenyl-1,3-thiazol-4-yl)pentyl]aniline (PubChem CID 58933101) has the molecular formula C24H30N2S and a molecular weight of 378.59 g/mol. Its IUPAC name is 4-butyl-N-[1-(2-phenyl-1,3-thiazol-4-yl)pentyl]aniline.
| Compound Name | 4-butyl-N-[1-(2-phenyl-1,3-thiazol-4-yl)pentyl]aniline |
|---|---|
| PubChem CID | 58933101 |
| Molecular Formula | C24H30N2S |
| Molecular Weight | 378.59 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 4-butyl-N-[1-(2-phenyl-1,3-thiazol-4-yl)pentyl]aniline |
| SMILES | CCCCc1ccc(NC(CCCC)c2csc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C24H30N2S/c1-3-5-10-19-14-16-21(17-15-19)25-22(13-6-4-2)23-18-27-24(26-23)20-11-8-7-9-12-20/h7-9,11-12,14-18,22,25H,3-6,10,13H2,1-2H3 |
| InChIKey | KCBJIXKKNPYEQY-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.59 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |